C14H21N — CID 62548706
3-[(2,3-dimethylphenyl)methyl]piperidine (PubChem CID 62548706) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 3-[(2,3-dimethylphenyl)methyl]piperidine.
| Compound Name | 3-[(2,3-dimethylphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 62548706 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 3-[(2,3-dimethylphenyl)methyl]piperidine |
| SMILES | Cc1cccc(CC2CCCNC2)c1C |
| InChI | InChI=1S/C14H21N/c1-11-5-3-7-14(12(11)2)9-13-6-4-8-15-10-13/h3,5,7,13,15H,4,6,8-10H2,1-2H3 |
| InChIKey | KIRJKWJSOLMTRN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |