C12H10Cl2N2S — CID 62549980
2-(2,6-dichlorophenyl)-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 62549980) has the molecular formula C12H10Cl2N2S and a molecular weight of 285.20 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine.
| Compound Name | 2-(2,6-dichlorophenyl)-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 62549980 |
| Molecular Formula | C12H10Cl2N2S |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | Clc1cccc(Cl)c1-c1nc2c(s1)CNCC2 |
| InChI | InChI=1S/C12H10Cl2N2S/c13-7-2-1-3-8(14)11(7)12-16-9-4-5-15-6-10(9)17-12/h1-3,15H,4-6H2 |
| InChIKey | NVJPCPJFVAHTRN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |