About [3,5-dimethyl-1-(oxolan-2-ylmethyl)pyrazol-4-yl]methanamine
[3,5-dimethyl-1-(oxolan-2-ylmethyl)pyrazol-4-yl]methanamine (PubChem CID 62550168) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is [3,5-dimethyl-1-(oxolan-2-ylmethyl)pyrazol-4-yl]methanamine.
Molecular Properties
| Compound Name | [3,5-dimethyl-1-(oxolan-2-ylmethyl)pyrazol-4-yl]methanamine |
| PubChem CID | 62550168 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | [3,5-dimethyl-1-(oxolan-2-ylmethyl)pyrazol-4-yl]methanamine |
| SMILES | Cc1nn(CC2CCCO2)c(C)c1CN |
| InChI | InChI=1S/C11H19N3O/c1-8-11(6-12)9(2)14(13-8)7-10-4-3-5-15-10/h10H,3-7,12H2,1-2H3 |
| InChIKey | MJGQGCPDBVCAMC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3,5-dimethyl-1-(oxolan-2-ylmethyl)pyrazol-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dimethyl-1-(oxolan-2-ylmethyl)pyrazol-4-yl]methanamine?
The IUPAC name of [3,5-dimethyl-1-(oxolan-2-ylmethyl)pyrazol-4-yl]methanamine (CID 62550168) is [3,5-dimethyl-1-(oxolan-2-ylmethyl)pyrazol-4-yl]methanamine.
What is the SMILES notation for [3,5-dimethyl-1-(oxolan-2-ylmethyl)pyrazol-4-yl]methanamine?
The canonical SMILES for [3,5-dimethyl-1-(oxolan-2-ylmethyl)pyrazol-4-yl]methanamine is Cc1nn(CC2CCCO2)c(C)c1CN.
What is the InChIKey of [3,5-dimethyl-1-(oxolan-2-ylmethyl)pyrazol-4-yl]methanamine?
The InChIKey is MJGQGCPDBVCAMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O/c1-8-11(6-12)9(2)14(13-8)7-10-4-3-5-15-10/h10H,3-7,12H2,1-2H3.
What are the key properties of [3,5-dimethyl-1-(oxolan-2-ylmethyl)pyrazol-4-yl]methanamine?
[3,5-dimethyl-1-(oxolan-2-ylmethyl)pyrazol-4-yl]methanamine has a molecular weight of 209.29 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dimethyl-1-(oxolan-2-ylmethyl)pyrazol-4-yl]methanamine is sourced from PubChem (CID 62550168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).