C14H10F2N4O — CID 62551044
2,4-difluoro-5-[3-(pyridin-3-ylmethyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 62551044) has the molecular formula C14H10F2N4O and a molecular weight of 288.26 g/mol. Its IUPAC name is 2,4-difluoro-5-[3-(pyridin-3-ylmethyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2,4-difluoro-5-[3-(pyridin-3-ylmethyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 62551044 |
| Molecular Formula | C14H10F2N4O |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2,4-difluoro-5-[3-(pyridin-3-ylmethyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1cc(-c2nc(Cc3cccnc3)no2)c(F)cc1F |
| InChI | InChI=1S/C14H10F2N4O/c15-10-6-11(16)12(17)5-9(10)14-19-13(20-21-14)4-8-2-1-3-18-7-8/h1-3,5-7H,4,17H2 |
| InChIKey | RDCVEIDSMGWIBC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|