C11H21NO5S — CID 62552006
4-[[1-(hydroxymethyl)cyclohexyl]sulfamoyl]butanoic acid (PubChem CID 62552006) has the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. Its IUPAC name is 4-[[1-(hydroxymethyl)cyclohexyl]sulfamoyl]butanoic acid.
| Compound Name | 4-[[1-(hydroxymethyl)cyclohexyl]sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 62552006 |
| Molecular Formula | C11H21NO5S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 4-[[1-(hydroxymethyl)cyclohexyl]sulfamoyl]butanoic acid |
| SMILES | O=C(O)CCCS(=O)(=O)NC1(CO)CCCCC1 |
| InChI | InChI=1S/C11H21NO5S/c13-9-11(6-2-1-3-7-11)12-18(16,17)8-4-5-10(14)15/h12-13H,1-9H2,(H,14,15) |
| InChIKey | PHSMRILMFNLEOF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |