About [1-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methylcyclohexyl]methanol
[1-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methylcyclohexyl]methanol (PubChem CID 62552477) has the molecular formula C16H23N3OS
and a molecular weight of 305.45 g/mol. Its IUPAC name is [1-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methylcyclohexyl]methanol.
Molecular Properties
| Compound Name | [1-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methylcyclohexyl]methanol |
| PubChem CID | 62552477 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | [1-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methylcyclohexyl]methanol |
| SMILES | Cc1nc2cc(NC3(CO)CCC(C)CC3)c(N)cc2s1 |
| InChI | InChI=1S/C16H23N3OS/c1-10-3-5-16(9-20,6-4-10)19-13-8-14-15(7-12(13)17)21-11(2)18-14/h7-8,10,19-20H,3-6,9,17H2,1-2H3 |
| InChIKey | GDEDLKSCAYTEEQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [1-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methylcyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methylcyclohexyl]methanol?
The IUPAC name of [1-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methylcyclohexyl]methanol (CID 62552477) is [1-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methylcyclohexyl]methanol.
What is the SMILES notation for [1-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methylcyclohexyl]methanol?
The canonical SMILES for [1-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methylcyclohexyl]methanol is Cc1nc2cc(NC3(CO)CCC(C)CC3)c(N)cc2s1.
What is the InChIKey of [1-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methylcyclohexyl]methanol?
The InChIKey is GDEDLKSCAYTEEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3OS/c1-10-3-5-16(9-20,6-4-10)19-13-8-14-15(7-12(13)17)21-11(2)18-14/h7-8,10,19-20H,3-6,9,17H2,1-2H3.
What are the key properties of [1-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methylcyclohexyl]methanol?
[1-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methylcyclohexyl]methanol has a molecular weight of 305.45 g/mol, XLogP of 3.54, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methylcyclohexyl]methanol is sourced from PubChem (CID 62552477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).