About [1-[(1,1-dioxothian-4-yl)amino]-3-methylcyclohexyl]methanol
[1-[(1,1-dioxothian-4-yl)amino]-3-methylcyclohexyl]methanol (PubChem CID 62552486) has the molecular formula C13H25NO3S
and a molecular weight of 275.41 g/mol. Its IUPAC name is [1-[(1,1-dioxothian-4-yl)amino]-3-methylcyclohexyl]methanol.
Molecular Properties
| Compound Name | [1-[(1,1-dioxothian-4-yl)amino]-3-methylcyclohexyl]methanol |
| PubChem CID | 62552486 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | [1-[(1,1-dioxothian-4-yl)amino]-3-methylcyclohexyl]methanol |
| SMILES | CC1CCCC(CO)(NC2CCS(=O)(=O)CC2)C1 |
| InChI | InChI=1S/C13H25NO3S/c1-11-3-2-6-13(9-11,10-15)14-12-4-7-18(16,17)8-5-12/h11-12,14-15H,2-10H2,1H3 |
| InChIKey | WRPWYQKQYNRGNS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(1,1-dioxothian-4-yl)amino]-3-methylcyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(1,1-dioxothian-4-yl)amino]-3-methylcyclohexyl]methanol?
The IUPAC name of [1-[(1,1-dioxothian-4-yl)amino]-3-methylcyclohexyl]methanol (CID 62552486) is [1-[(1,1-dioxothian-4-yl)amino]-3-methylcyclohexyl]methanol.
What is the SMILES notation for [1-[(1,1-dioxothian-4-yl)amino]-3-methylcyclohexyl]methanol?
The canonical SMILES for [1-[(1,1-dioxothian-4-yl)amino]-3-methylcyclohexyl]methanol is CC1CCCC(CO)(NC2CCS(=O)(=O)CC2)C1.
What is the InChIKey of [1-[(1,1-dioxothian-4-yl)amino]-3-methylcyclohexyl]methanol?
The InChIKey is WRPWYQKQYNRGNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3S/c1-11-3-2-6-13(9-11,10-15)14-12-4-7-18(16,17)8-5-12/h11-12,14-15H,2-10H2,1H3.
What are the key properties of [1-[(1,1-dioxothian-4-yl)amino]-3-methylcyclohexyl]methanol?
[1-[(1,1-dioxothian-4-yl)amino]-3-methylcyclohexyl]methanol has a molecular weight of 275.41 g/mol, XLogP of 1.09, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(1,1-dioxothian-4-yl)amino]-3-methylcyclohexyl]methanol is sourced from PubChem (CID 62552486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).