About 4-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]-1,1-dioxothiolan-3-ol
4-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]-1,1-dioxothiolan-3-ol (PubChem CID 62553542) has the molecular formula C12H23NO4S
and a molecular weight of 277.39 g/mol. Its IUPAC name is 4-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]-1,1-dioxothiolan-3-ol |
| PubChem CID | 62553542 |
| Molecular Formula | C12H23NO4S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 4-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]-1,1-dioxothiolan-3-ol |
| SMILES | CC1CCCC(CO)(NC2CS(=O)(=O)CC2O)C1 |
| InChI | InChI=1S/C12H23NO4S/c1-9-3-2-4-12(5-9,8-14)13-10-6-18(16,17)7-11(10)15/h9-11,13-15H,2-8H2,1H3 |
| InChIKey | ZWWFNVNZQSFEHA-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]-1,1-dioxothiolan-3-ol (CID 62553542) is 4-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]-1,1-dioxothiolan-3-ol is CC1CCCC(CO)(NC2CS(=O)(=O)CC2O)C1.
What is the InChIKey of 4-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]-1,1-dioxothiolan-3-ol?
The InChIKey is ZWWFNVNZQSFEHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO4S/c1-9-3-2-4-12(5-9,8-14)13-10-6-18(16,17)7-11(10)15/h9-11,13-15H,2-8H2,1H3.
What are the key properties of 4-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]-1,1-dioxothiolan-3-ol?
4-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]-1,1-dioxothiolan-3-ol has a molecular weight of 277.39 g/mol, XLogP of -0.32, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-(hydroxymethyl)-3-methylcyclohexyl]amino]-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 62553542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).