C12H18BrF3N2S — CID 62553677
N-[(4-bromothiophen-2-yl)methyl]-N'-propyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 62553677) has the molecular formula C12H18BrF3N2S and a molecular weight of 359.26 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N'-propyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N'-propyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62553677 |
| Molecular Formula | C12H18BrF3N2S |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N'-propyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CCCN(CCNCc1cc(Br)cs1)CC(F)(F)F |
| InChI | InChI=1S/C12H18BrF3N2S/c1-2-4-18(9-12(14,15)16)5-3-17-7-11-6-10(13)8-19-11/h6,8,17H,2-5,7,9H2,1H3 |
| InChIKey | STCGBBXRIDTQHV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|