C11H16BrF3N2S — CID 62554162
N-[(4-bromothiophen-2-yl)methyl]-N'-ethyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 62554162) has the molecular formula C11H16BrF3N2S and a molecular weight of 345.23 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N'-ethyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N'-ethyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62554162 |
| Molecular Formula | C11H16BrF3N2S |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N'-ethyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CCN(CCNCc1cc(Br)cs1)CC(F)(F)F |
| InChI | InChI=1S/C11H16BrF3N2S/c1-2-17(8-11(13,14)15)4-3-16-6-10-5-9(12)7-18-10/h5,7,16H,2-4,6,8H2,1H3 |
| InChIKey | KUBBCDGRYVTXDU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|