C12H16BrF3N2S — CID 62554824
N-[(4-bromothiophen-2-yl)methyl]-N'-cyclopropyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 62554824) has the molecular formula C12H16BrF3N2S and a molecular weight of 357.24 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N'-cyclopropyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N'-cyclopropyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62554824 |
| Molecular Formula | C12H16BrF3N2S |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N'-cyclopropyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | FC(F)(F)CN(CCNCc1cc(Br)cs1)C1CC1 |
| InChI | InChI=1S/C12H16BrF3N2S/c13-9-5-11(19-7-9)6-17-3-4-18(10-1-2-10)8-12(14,15)16/h5,7,10,17H,1-4,6,8H2 |
| InChIKey | DSDBLLMLZDQJOV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|