C11H21F3N2O — CID 62555443
2,2,2-trifluoro-N-[2-(2,2,6-trimethylmorpholin-4-yl)ethyl]ethanamine (PubChem CID 62555443) has the molecular formula C11H21F3N2O and a molecular weight of 254.30 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(2,2,6-trimethylmorpholin-4-yl)ethyl]ethanamine.
| Compound Name | 2,2,2-trifluoro-N-[2-(2,2,6-trimethylmorpholin-4-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 62555443 |
| Molecular Formula | C11H21F3N2O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(2,2,6-trimethylmorpholin-4-yl)ethyl]ethanamine |
| SMILES | CC1CN(CCNCC(F)(F)F)CC(C)(C)O1 |
| InChI | InChI=1S/C11H21F3N2O/c1-9-6-16(8-10(2,3)17-9)5-4-15-7-11(12,13)14/h9,15H,4-8H2,1-3H3 |
| InChIKey | RKMZJMXZCPMJTQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|