About N'-(cyclopropylmethyl)-N-(4-methylphenyl)-N'-propylethane-1,2-diamine
N'-(cyclopropylmethyl)-N-(4-methylphenyl)-N'-propylethane-1,2-diamine (PubChem CID 62555539) has the molecular formula C16H26N2
and a molecular weight of 246.40 g/mol. Its IUPAC name is N'-(cyclopropylmethyl)-N-(4-methylphenyl)-N'-propylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(cyclopropylmethyl)-N-(4-methylphenyl)-N'-propylethane-1,2-diamine |
| PubChem CID | 62555539 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N'-(cyclopropylmethyl)-N-(4-methylphenyl)-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CCNc1ccc(C)cc1)CC1CC1 |
| InChI | InChI=1S/C16H26N2/c1-3-11-18(13-15-6-7-15)12-10-17-16-8-4-14(2)5-9-16/h4-5,8-9,15,17H,3,6-7,10-13H2,1-2H3 |
| InChIKey | JOFRZFQLBWWAEW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-(cyclopropylmethyl)-N-(4-methylphenyl)-N'-propylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(cyclopropylmethyl)-N-(4-methylphenyl)-N'-propylethane-1,2-diamine?
The IUPAC name of N'-(cyclopropylmethyl)-N-(4-methylphenyl)-N'-propylethane-1,2-diamine (CID 62555539) is N'-(cyclopropylmethyl)-N-(4-methylphenyl)-N'-propylethane-1,2-diamine.
What is the SMILES notation for N'-(cyclopropylmethyl)-N-(4-methylphenyl)-N'-propylethane-1,2-diamine?
The canonical SMILES for N'-(cyclopropylmethyl)-N-(4-methylphenyl)-N'-propylethane-1,2-diamine is CCCN(CCNc1ccc(C)cc1)CC1CC1.
What is the InChIKey of N'-(cyclopropylmethyl)-N-(4-methylphenyl)-N'-propylethane-1,2-diamine?
The InChIKey is JOFRZFQLBWWAEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2/c1-3-11-18(13-15-6-7-15)12-10-17-16-8-4-14(2)5-9-16/h4-5,8-9,15,17H,3,6-7,10-13H2,1-2H3.
What are the key properties of N'-(cyclopropylmethyl)-N-(4-methylphenyl)-N'-propylethane-1,2-diamine?
N'-(cyclopropylmethyl)-N-(4-methylphenyl)-N'-propylethane-1,2-diamine has a molecular weight of 246.40 g/mol, XLogP of 3.53, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(cyclopropylmethyl)-N-(4-methylphenyl)-N'-propylethane-1,2-diamine is sourced from PubChem (CID 62555539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).