C13H27F3N2 — CID 62555799
N-(4-methylpentyl)-N'-propan-2-yl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 62555799) has the molecular formula C13H27F3N2 and a molecular weight of 268.37 g/mol. Its IUPAC name is N-(4-methylpentyl)-N'-propan-2-yl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N-(4-methylpentyl)-N'-propan-2-yl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62555799 |
| Molecular Formula | C13H27F3N2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.21 |
| IUPAC Name | N-(4-methylpentyl)-N'-propan-2-yl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CC(C)CCCNCCN(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C13H27F3N2/c1-11(2)6-5-7-17-8-9-18(12(3)4)10-13(14,15)16/h11-12,17H,5-10H2,1-4H3 |
| InChIKey | YTZGPPJMUCLZIC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|