C16H20FN3 — CID 62555848
N'-ethyl-N'-(2-fluorophenyl)-N-(pyridin-3-ylmethyl)ethane-1,2-diamine (PubChem CID 62555848) has the molecular formula C16H20FN3 and a molecular weight of 273.36 g/mol. Its IUPAC name is N'-ethyl-N'-(2-fluorophenyl)-N-(pyridin-3-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-(2-fluorophenyl)-N-(pyridin-3-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62555848 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | N'-ethyl-N'-(2-fluorophenyl)-N-(pyridin-3-ylmethyl)ethane-1,2-diamine |
| SMILES | CCN(CCNCc1cccnc1)c1ccccc1F |
| InChI | InChI=1S/C16H20FN3/c1-2-20(16-8-4-3-7-15(16)17)11-10-19-13-14-6-5-9-18-12-14/h3-9,12,19H,2,10-11,13H2,1H3 |
| InChIKey | WEIARJZPOVHHNI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|