C12H18BrF3N2S — CID 62556124
N-[(4-bromothiophen-2-yl)methyl]-N'-propan-2-yl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 62556124) has the molecular formula C12H18BrF3N2S and a molecular weight of 359.26 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N'-propan-2-yl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N'-propan-2-yl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62556124 |
| Molecular Formula | C12H18BrF3N2S |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N'-propan-2-yl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CC(C)N(CCNCc1cc(Br)cs1)CC(F)(F)F |
| InChI | InChI=1S/C12H18BrF3N2S/c1-9(2)18(8-12(14,15)16)4-3-17-6-11-5-10(13)7-19-11/h5,7,9,17H,3-4,6,8H2,1-2H3 |
| InChIKey | UAZUHPYVHLAGFK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|