C10H21F3N2O2S — CID 62556137
N-(2-methylsulfonylethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 62556137) has the molecular formula C10H21F3N2O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is N-(2-methylsulfonylethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N-(2-methylsulfonylethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62556137 |
| Molecular Formula | C10H21F3N2O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-(2-methylsulfonylethyl)-N'-propyl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CCCN(CCNCCS(C)(=O)=O)CC(F)(F)F |
| InChI | InChI=1S/C10H21F3N2O2S/c1-3-6-15(9-10(11,12)13)7-4-14-5-8-18(2,16)17/h14H,3-9H2,1-2H3 |
| InChIKey | YDWFZDJCNRJJPT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|