C14H30N2 — CID 62557751
N-butyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine (PubChem CID 62557751) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is N-butyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N-butyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62557751 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N-butyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine |
| SMILES | CCCCNCCN(C)CC1CCCCC1 |
| InChI | InChI=1S/C14H30N2/c1-3-4-10-15-11-12-16(2)13-14-8-6-5-7-9-14/h14-15H,3-13H2,1-2H3 |
| InChIKey | RHEOTVZYPMKBPP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|