C13H18N2O2 — CID 62558206
N-(furan-2-ylmethyl)-N'-(furan-3-ylmethyl)-N'-methylethane-1,2-diamine (PubChem CID 62558206) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-(furan-3-ylmethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N-(furan-2-ylmethyl)-N'-(furan-3-ylmethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62558206 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-(furan-3-ylmethyl)-N'-methylethane-1,2-diamine |
| SMILES | CN(CCNCc1ccco1)Cc1ccoc1 |
| InChI | InChI=1S/C13H18N2O2/c1-15(10-12-4-8-16-11-12)6-5-14-9-13-3-2-7-17-13/h2-4,7-8,11,14H,5-6,9-10H2,1H3 |
| InChIKey | LDHCLKKNWAJFKP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 41.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|