C17H24N2O2 — CID 62558505
2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-prop-2-ynylpropan-1-amine (PubChem CID 62558505) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-prop-2-ynylpropan-1-amine.
| Compound Name | 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-prop-2-ynylpropan-1-amine |
|---|---|
| PubChem CID | 62558505 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-prop-2-ynylpropan-1-amine |
| SMILES | C#CCNCC(C)N1CCc2cc(OC)c(OC)cc2C1 |
| InChI | InChI=1S/C17H24N2O2/c1-5-7-18-11-13(2)19-8-6-14-9-16(20-3)17(21-4)10-15(14)12-19/h1,9-10,13,18H,6-8,11-12H2,2-4H3 |
| InChIKey | UKEGGEISBVPHEJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|