About N-benzyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine
N-benzyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine (PubChem CID 62558621) has the molecular formula C17H28N2
and a molecular weight of 260.43 g/mol. Its IUPAC name is N-benzyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-benzyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine |
| PubChem CID | 62558621 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-benzyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine |
| SMILES | CN(CCNCc1ccccc1)CC1CCCCC1 |
| InChI | InChI=1S/C17H28N2/c1-19(15-17-10-6-3-7-11-17)13-12-18-14-16-8-4-2-5-9-16/h2,4-5,8-9,17-18H,3,6-7,10-15H2,1H3 |
| InChIKey | MAGKRLHDSRKAKT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine?
The IUPAC name of N-benzyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine (CID 62558621) is N-benzyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N-benzyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N-benzyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine is CN(CCNCc1ccccc1)CC1CCCCC1.
What is the InChIKey of N-benzyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine?
The InChIKey is MAGKRLHDSRKAKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2/c1-19(15-17-10-6-3-7-11-17)13-12-18-14-16-8-4-2-5-9-16/h2,4-5,8-9,17-18H,3,6-7,10-15H2,1H3.
What are the key properties of N-benzyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine?
N-benzyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine has a molecular weight of 260.43 g/mol, XLogP of 3.29, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N'-(cyclohexylmethyl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 62558621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).