About N-(1,1-dioxothiolan-3-yl)-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine
N-(1,1-dioxothiolan-3-yl)-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine (PubChem CID 62558624) has the molecular formula C13H22N2O3S
and a molecular weight of 286.40 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine |
| PubChem CID | 62558624 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine |
| SMILES | Cc1occc1CN(C)CCNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H22N2O3S/c1-11-12(3-7-18-11)9-15(2)6-5-14-13-4-8-19(16,17)10-13/h3,7,13-14H,4-6,8-10H2,1-2H3 |
| InChIKey | CDYVHGVJNRQPHX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,1-dioxothiolan-3-yl)-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dioxothiolan-3-yl)-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine?
The IUPAC name of N-(1,1-dioxothiolan-3-yl)-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine (CID 62558624) is N-(1,1-dioxothiolan-3-yl)-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine.
What is the SMILES notation for N-(1,1-dioxothiolan-3-yl)-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine?
The canonical SMILES for N-(1,1-dioxothiolan-3-yl)-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine is Cc1occc1CN(C)CCNC1CCS(=O)(=O)C1.
What is the InChIKey of N-(1,1-dioxothiolan-3-yl)-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine?
The InChIKey is CDYVHGVJNRQPHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O3S/c1-11-12(3-7-18-11)9-15(2)6-5-14-13-4-8-19(16,17)10-13/h3,7,13-14H,4-6,8-10H2,1-2H3.
What are the key properties of N-(1,1-dioxothiolan-3-yl)-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine?
N-(1,1-dioxothiolan-3-yl)-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine has a molecular weight of 286.40 g/mol, XLogP of 0.80, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dioxothiolan-3-yl)-N'-methyl-N'-[(2-methylfuran-3-yl)methyl]ethane-1,2-diamine is sourced from PubChem (CID 62558624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).