About N-[2-(2,4-dimethylpiperidin-1-yl)ethyl]prop-2-en-1-amine
N-[2-(2,4-dimethylpiperidin-1-yl)ethyl]prop-2-en-1-amine (PubChem CID 62559936) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is N-[2-(2,4-dimethylpiperidin-1-yl)ethyl]prop-2-en-1-amine.
Molecular Properties
| Compound Name | N-[2-(2,4-dimethylpiperidin-1-yl)ethyl]prop-2-en-1-amine |
| PubChem CID | 62559936 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N-[2-(2,4-dimethylpiperidin-1-yl)ethyl]prop-2-en-1-amine |
| SMILES | C=CCNCCN1CCC(C)CC1C |
| InChI | InChI=1S/C12H24N2/c1-4-6-13-7-9-14-8-5-11(2)10-12(14)3/h4,11-13H,1,5-10H2,2-3H3 |
| InChIKey | GVQWXPKCLUNDPA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,4-dimethylpiperidin-1-yl)ethyl]prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,4-dimethylpiperidin-1-yl)ethyl]prop-2-en-1-amine?
The IUPAC name of N-[2-(2,4-dimethylpiperidin-1-yl)ethyl]prop-2-en-1-amine (CID 62559936) is N-[2-(2,4-dimethylpiperidin-1-yl)ethyl]prop-2-en-1-amine.
What is the SMILES notation for N-[2-(2,4-dimethylpiperidin-1-yl)ethyl]prop-2-en-1-amine?
The canonical SMILES for N-[2-(2,4-dimethylpiperidin-1-yl)ethyl]prop-2-en-1-amine is C=CCNCCN1CCC(C)CC1C.
What is the InChIKey of N-[2-(2,4-dimethylpiperidin-1-yl)ethyl]prop-2-en-1-amine?
The InChIKey is GVQWXPKCLUNDPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-4-6-13-7-9-14-8-5-11(2)10-12(14)3/h4,11-13H,1,5-10H2,2-3H3.
What are the key properties of N-[2-(2,4-dimethylpiperidin-1-yl)ethyl]prop-2-en-1-amine?
N-[2-(2,4-dimethylpiperidin-1-yl)ethyl]prop-2-en-1-amine has a molecular weight of 196.34 g/mol, XLogP of 1.88, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,4-dimethylpiperidin-1-yl)ethyl]prop-2-en-1-amine is sourced from PubChem (CID 62559936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).