C10H22N2O — CID 62560137
N-(oxolan-3-ylmethyl)-N'-propan-2-ylethane-1,2-diamine (PubChem CID 62560137) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is N-(oxolan-3-ylmethyl)-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-(oxolan-3-ylmethyl)-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 62560137 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | N-(oxolan-3-ylmethyl)-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)NCCNCC1CCOC1 |
| InChI | InChI=1S/C10H22N2O/c1-9(2)12-5-4-11-7-10-3-6-13-8-10/h9-12H,3-8H2,1-2H3 |
| InChIKey | QTIVJUKDUFWYIN-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|