About N-(cyclohexylmethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine
N-(cyclohexylmethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine (PubChem CID 62561222) has the molecular formula C15H32N2O2
and a molecular weight of 272.43 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(cyclohexylmethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine |
| PubChem CID | 62561222 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | N-(cyclohexylmethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine |
| SMILES | COCCN(CCNCC1CCCCC1)CCOC |
| InChI | InChI=1S/C15H32N2O2/c1-18-12-10-17(11-13-19-2)9-8-16-14-15-6-4-3-5-7-15/h15-16H,3-14H2,1-2H3 |
| InChIKey | DVOZZFYXWGLWRS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclohexylmethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexylmethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine?
The IUPAC name of N-(cyclohexylmethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine (CID 62561222) is N-(cyclohexylmethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine.
What is the SMILES notation for N-(cyclohexylmethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine?
The canonical SMILES for N-(cyclohexylmethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine is COCCN(CCNCC1CCCCC1)CCOC.
What is the InChIKey of N-(cyclohexylmethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine?
The InChIKey is DVOZZFYXWGLWRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2O2/c1-18-12-10-17(11-13-19-2)9-8-16-14-15-6-4-3-5-7-15/h15-16H,3-14H2,1-2H3.
What are the key properties of N-(cyclohexylmethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine?
N-(cyclohexylmethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine has a molecular weight of 272.43 g/mol, XLogP of 1.75, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexylmethyl)-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine is sourced from PubChem (CID 62561222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).