About N'-methyl-N-(oxolan-3-ylmethyl)-N'-(thiolan-3-yl)ethane-1,2-diamine
N'-methyl-N-(oxolan-3-ylmethyl)-N'-(thiolan-3-yl)ethane-1,2-diamine (PubChem CID 62561876) has the molecular formula C12H24N2OS
and a molecular weight of 244.40 g/mol. Its IUPAC name is N'-methyl-N-(oxolan-3-ylmethyl)-N'-(thiolan-3-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-methyl-N-(oxolan-3-ylmethyl)-N'-(thiolan-3-yl)ethane-1,2-diamine |
| PubChem CID | 62561876 |
| Molecular Formula | C12H24N2OS |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N'-methyl-N-(oxolan-3-ylmethyl)-N'-(thiolan-3-yl)ethane-1,2-diamine |
| SMILES | CN(CCNCC1CCOC1)C1CCSC1 |
| InChI | InChI=1S/C12H24N2OS/c1-14(12-3-7-16-10-12)5-4-13-8-11-2-6-15-9-11/h11-13H,2-10H2,1H3 |
| InChIKey | WZVRUNYAHWNBEN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N-(oxolan-3-ylmethyl)-N'-(thiolan-3-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N-(oxolan-3-ylmethyl)-N'-(thiolan-3-yl)ethane-1,2-diamine?
The IUPAC name of N'-methyl-N-(oxolan-3-ylmethyl)-N'-(thiolan-3-yl)ethane-1,2-diamine (CID 62561876) is N'-methyl-N-(oxolan-3-ylmethyl)-N'-(thiolan-3-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-methyl-N-(oxolan-3-ylmethyl)-N'-(thiolan-3-yl)ethane-1,2-diamine?
The canonical SMILES for N'-methyl-N-(oxolan-3-ylmethyl)-N'-(thiolan-3-yl)ethane-1,2-diamine is CN(CCNCC1CCOC1)C1CCSC1.
What is the InChIKey of N'-methyl-N-(oxolan-3-ylmethyl)-N'-(thiolan-3-yl)ethane-1,2-diamine?
The InChIKey is WZVRUNYAHWNBEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2OS/c1-14(12-3-7-16-10-12)5-4-13-8-11-2-6-15-9-11/h11-13H,2-10H2,1H3.
What are the key properties of N'-methyl-N-(oxolan-3-ylmethyl)-N'-(thiolan-3-yl)ethane-1,2-diamine?
N'-methyl-N-(oxolan-3-ylmethyl)-N'-(thiolan-3-yl)ethane-1,2-diamine has a molecular weight of 244.40 g/mol, XLogP of 1.05, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N-(oxolan-3-ylmethyl)-N'-(thiolan-3-yl)ethane-1,2-diamine is sourced from PubChem (CID 62561876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).