About 3-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]butan-2-amine
3-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]butan-2-amine (PubChem CID 62562608) has the molecular formula C9H18N4
and a molecular weight of 182.27 g/mol. Its IUPAC name is 3-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]butan-2-amine.
Analyze 3-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]butan-2-amine?
The IUPAC name of 3-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]butan-2-amine (CID 62562608) is 3-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]butan-2-amine.
What is the SMILES notation for 3-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]butan-2-amine?
The canonical SMILES for 3-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]butan-2-amine is CC(C)C(C)NCCn1cncn1.
What is the InChIKey of 3-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]butan-2-amine?
The InChIKey is XNTBXZYNSKNEKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4/c1-8(2)9(3)11-4-5-13-7-10-6-12-13/h6-9,11H,4-5H2,1-3H3.
What are the key properties of 3-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]butan-2-amine?
3-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]butan-2-amine has a molecular weight of 182.27 g/mol, XLogP of 0.91, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]butan-2-amine is sourced from PubChem (CID 62562608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).