C10H10F3N3OS — CID 62562983
3-[2-(2,2,2-trifluoroethylamino)ethyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 62562983) has the molecular formula C10H10F3N3OS and a molecular weight of 277.27 g/mol. Its IUPAC name is 3-[2-(2,2,2-trifluoroethylamino)ethyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[2-(2,2,2-trifluoroethylamino)ethyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 62562983 |
| Molecular Formula | C10H10F3N3OS |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 3-[2-(2,2,2-trifluoroethylamino)ethyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2ccsc2ncn1CCNCC(F)(F)F |
| InChI | InChI=1S/C10H10F3N3OS/c11-10(12,13)5-14-2-3-16-6-15-8-7(9(16)17)1-4-18-8/h1,4,6,14H,2-3,5H2 |
| InChIKey | UTBNLTRXWCQNLB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|