About N-[4-(5,6-difluorobenzimidazol-1-yl)butyl]cyclopropanamine
N-[4-(5,6-difluorobenzimidazol-1-yl)butyl]cyclopropanamine (PubChem CID 62564114) has the molecular formula C14H17F2N3
and a molecular weight of 265.31 g/mol. Its IUPAC name is N-[4-(5,6-difluorobenzimidazol-1-yl)butyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[4-(5,6-difluorobenzimidazol-1-yl)butyl]cyclopropanamine |
| PubChem CID | 62564114 |
| Molecular Formula | C14H17F2N3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N-[4-(5,6-difluorobenzimidazol-1-yl)butyl]cyclopropanamine |
| SMILES | Fc1cc2ncn(CCCCNC3CC3)c2cc1F |
| InChI | InChI=1S/C14H17F2N3/c15-11-7-13-14(8-12(11)16)19(9-18-13)6-2-1-5-17-10-3-4-10/h7-10,17H,1-6H2 |
| InChIKey | FOVBKMLORLPRAH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(5,6-difluorobenzimidazol-1-yl)butyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(5,6-difluorobenzimidazol-1-yl)butyl]cyclopropanamine?
The IUPAC name of N-[4-(5,6-difluorobenzimidazol-1-yl)butyl]cyclopropanamine (CID 62564114) is N-[4-(5,6-difluorobenzimidazol-1-yl)butyl]cyclopropanamine.
What is the SMILES notation for N-[4-(5,6-difluorobenzimidazol-1-yl)butyl]cyclopropanamine?
The canonical SMILES for N-[4-(5,6-difluorobenzimidazol-1-yl)butyl]cyclopropanamine is Fc1cc2ncn(CCCCNC3CC3)c2cc1F.
What is the InChIKey of N-[4-(5,6-difluorobenzimidazol-1-yl)butyl]cyclopropanamine?
The InChIKey is FOVBKMLORLPRAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2N3/c15-11-7-13-14(8-12(11)16)19(9-18-13)6-2-1-5-17-10-3-4-10/h7-10,17H,1-6H2.
What are the key properties of N-[4-(5,6-difluorobenzimidazol-1-yl)butyl]cyclopropanamine?
N-[4-(5,6-difluorobenzimidazol-1-yl)butyl]cyclopropanamine has a molecular weight of 265.31 g/mol, XLogP of 2.85, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(5,6-difluorobenzimidazol-1-yl)butyl]cyclopropanamine is sourced from PubChem (CID 62564114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).