C9H16N4 — CID 62565134
N-[2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethyl]prop-2-en-1-amine (PubChem CID 62565134) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethyl]prop-2-en-1-amine.
| Compound Name | N-[2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 62565134 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | N-[2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethyl]prop-2-en-1-amine |
| SMILES | C=CCNCCn1nc(C)nc1C |
| InChI | InChI=1S/C9H16N4/c1-4-5-10-6-7-13-9(3)11-8(2)12-13/h4,10H,1,5-7H2,2-3H3 |
| InChIKey | CAKSLFNVFRYTKW-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|