C11H11BrF3N3S — CID 62566023
N-[(4-bromothiophen-2-yl)methyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]ethanamine (PubChem CID 62566023) has the molecular formula C11H11BrF3N3S and a molecular weight of 354.20 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 62566023 |
| Molecular Formula | C11H11BrF3N3S |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-[3-(trifluoromethyl)pyrazol-1-yl]ethanamine |
| SMILES | FC(F)(F)c1ccn(CCNCc2cc(Br)cs2)n1 |
| InChI | InChI=1S/C11H11BrF3N3S/c12-8-5-9(19-7-8)6-16-2-4-18-3-1-10(17-18)11(13,14)15/h1,3,5,7,16H,2,4,6H2 |
| InChIKey | CWQBYDNBTVUQKS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|