About N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]prop-2-yn-1-amine
N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]prop-2-yn-1-amine (PubChem CID 62566814) has the molecular formula C12H19N3
and a molecular weight of 205.30 g/mol. Its IUPAC name is N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]prop-2-yn-1-amine.
Molecular Properties
| Compound Name | N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]prop-2-yn-1-amine |
| PubChem CID | 62566814 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]prop-2-yn-1-amine |
| SMILES | C#CCNCCn1nc(C)c(CC)c1C |
| InChI | InChI=1S/C12H19N3/c1-5-7-13-8-9-15-11(4)12(6-2)10(3)14-15/h1,13H,6-9H2,2-4H3 |
| InChIKey | ACORCTPUMJXOND-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]prop-2-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]prop-2-yn-1-amine?
The IUPAC name of N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]prop-2-yn-1-amine (CID 62566814) is N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]prop-2-yn-1-amine.
What is the SMILES notation for N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]prop-2-yn-1-amine?
The canonical SMILES for N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]prop-2-yn-1-amine is C#CCNCCn1nc(C)c(CC)c1C.
What is the InChIKey of N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]prop-2-yn-1-amine?
The InChIKey is ACORCTPUMJXOND-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3/c1-5-7-13-8-9-15-11(4)12(6-2)10(3)14-15/h1,13H,6-9H2,2-4H3.
What are the key properties of N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]prop-2-yn-1-amine?
N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]prop-2-yn-1-amine has a molecular weight of 205.30 g/mol, XLogP of 1.29, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]prop-2-yn-1-amine is sourced from PubChem (CID 62566814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).