C9H13ClF3N3 — CID 62567154
N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-2,2,2-trifluoroethanamine (PubChem CID 62567154) has the molecular formula C9H13ClF3N3 and a molecular weight of 255.67 g/mol. Its IUPAC name is N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 62567154 |
| Molecular Formula | C9H13ClF3N3 |
| Molecular Weight | 255.67 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-2,2,2-trifluoroethanamine |
| SMILES | Cc1nn(CCNCC(F)(F)F)c(C)c1Cl |
| InChI | InChI=1S/C9H13ClF3N3/c1-6-8(10)7(2)16(15-6)4-3-14-5-9(11,12)13/h14H,3-5H2,1-2H3 |
| InChIKey | ORDWXTBPSFEWFD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.67 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|