C12H16N4 — CID 62567609
N-[2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethyl]aniline (PubChem CID 62567609) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethyl]aniline.
| Compound Name | N-[2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethyl]aniline |
|---|---|
| PubChem CID | 62567609 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | N-[2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethyl]aniline |
| SMILES | Cc1nc(C)n(CCNc2ccccc2)n1 |
| InChI | InChI=1S/C12H16N4/c1-10-14-11(2)16(15-10)9-8-13-12-6-4-3-5-7-12/h3-7,13H,8-9H2,1-2H3 |
| InChIKey | JCXRYAZSFDLNHS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |