About N-prop-2-enyl-2-(1,4-thiazepan-4-yl)propan-1-amine
N-prop-2-enyl-2-(1,4-thiazepan-4-yl)propan-1-amine (PubChem CID 62567842) has the molecular formula C11H22N2S
and a molecular weight of 214.38 g/mol. Its IUPAC name is N-prop-2-enyl-2-(1,4-thiazepan-4-yl)propan-1-amine.
Molecular Properties
| Compound Name | N-prop-2-enyl-2-(1,4-thiazepan-4-yl)propan-1-amine |
| PubChem CID | 62567842 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | N-prop-2-enyl-2-(1,4-thiazepan-4-yl)propan-1-amine |
| SMILES | C=CCNCC(C)N1CCCSCC1 |
| InChI | InChI=1S/C11H22N2S/c1-3-5-12-10-11(2)13-6-4-8-14-9-7-13/h3,11-12H,1,4-10H2,2H3 |
| InChIKey | VQHGQLFIRBOSSU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enyl-2-(1,4-thiazepan-4-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enyl-2-(1,4-thiazepan-4-yl)propan-1-amine?
The IUPAC name of N-prop-2-enyl-2-(1,4-thiazepan-4-yl)propan-1-amine (CID 62567842) is N-prop-2-enyl-2-(1,4-thiazepan-4-yl)propan-1-amine.
What is the SMILES notation for N-prop-2-enyl-2-(1,4-thiazepan-4-yl)propan-1-amine?
The canonical SMILES for N-prop-2-enyl-2-(1,4-thiazepan-4-yl)propan-1-amine is C=CCNCC(C)N1CCCSCC1.
What is the InChIKey of N-prop-2-enyl-2-(1,4-thiazepan-4-yl)propan-1-amine?
The InChIKey is VQHGQLFIRBOSSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2S/c1-3-5-12-10-11(2)13-6-4-8-14-9-7-13/h3,11-12H,1,4-10H2,2H3.
What are the key properties of N-prop-2-enyl-2-(1,4-thiazepan-4-yl)propan-1-amine?
N-prop-2-enyl-2-(1,4-thiazepan-4-yl)propan-1-amine has a molecular weight of 214.38 g/mol, XLogP of 1.59, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enyl-2-(1,4-thiazepan-4-yl)propan-1-amine is sourced from PubChem (CID 62567842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).