C11H13BrF3NO — CID 62570732
2-(4-bromophenoxy)-N-(2,2,2-trifluoroethyl)propan-1-amine (PubChem CID 62570732) has the molecular formula C11H13BrF3NO and a molecular weight of 312.13 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-(2,2,2-trifluoroethyl)propan-1-amine.
| Compound Name | 2-(4-bromophenoxy)-N-(2,2,2-trifluoroethyl)propan-1-amine |
|---|---|
| PubChem CID | 62570732 |
| Molecular Formula | C11H13BrF3NO |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 2-(4-bromophenoxy)-N-(2,2,2-trifluoroethyl)propan-1-amine |
| SMILES | CC(CNCC(F)(F)F)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H13BrF3NO/c1-8(6-16-7-11(13,14)15)17-10-4-2-9(12)3-5-10/h2-5,8,16H,6-7H2,1H3 |
| InChIKey | SSGVCHYYMIRBIY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |