C21H21ClNO3+ — CID 6257224
3-(2-chlorophenyl)-7-hydroxy-8-(piperidin-1-ium-1-ylmethyl)chromen-4-one (PubChem CID 6257224) has the molecular formula C21H21ClNO3+ and a molecular weight of 370.86 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-7-hydroxy-8-(piperidin-1-ium-1-ylmethyl)chromen-4-one.
| Compound Name | 3-(2-chlorophenyl)-7-hydroxy-8-(piperidin-1-ium-1-ylmethyl)chromen-4-one |
|---|---|
| PubChem CID | 6257224 |
| Molecular Formula | C21H21ClNO3+ |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 3-(2-chlorophenyl)-7-hydroxy-8-(piperidin-1-ium-1-ylmethyl)chromen-4-one |
| SMILES | O=c1c(-c2ccccc2Cl)coc2c(C[NH+]3CCCCC3)c(O)ccc12 |
| InChI | InChI=1S/C21H20ClNO3/c22-18-7-3-2-6-14(18)17-13-26-21-15(20(17)25)8-9-19(24)16(21)12-23-10-4-1-5-11-23/h2-3,6-9,13,24H,1,4-5,10-12H2/p+1 |
| InChIKey | JANOYIURUBBYQI-UHFFFAOYSA-O |
| XLogP | 3.39 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|