C15H33N3 — CID 62574097
N-hexyl-N'-methyl-N'-(1-methylpiperidin-4-yl)ethane-1,2-diamine (PubChem CID 62574097) has the molecular formula C15H33N3 and a molecular weight of 255.45 g/mol. Its IUPAC name is N-hexyl-N'-methyl-N'-(1-methylpiperidin-4-yl)ethane-1,2-diamine.
| Compound Name | N-hexyl-N'-methyl-N'-(1-methylpiperidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62574097 |
| Molecular Formula | C15H33N3 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.27 |
| IUPAC Name | N-hexyl-N'-methyl-N'-(1-methylpiperidin-4-yl)ethane-1,2-diamine |
| SMILES | CCCCCCNCCN(C)C1CCN(C)CC1 |
| InChI | InChI=1S/C15H33N3/c1-4-5-6-7-10-16-11-14-18(3)15-8-12-17(2)13-9-15/h15-16H,4-14H2,1-3H3 |
| InChIKey | KUYPGQXTPBSBFF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|