About N',N'-dimethyl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethane-1,2-diamine
N',N'-dimethyl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethane-1,2-diamine (PubChem CID 62574239) has the molecular formula C12H24F3N3
and a molecular weight of 267.34 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N',N'-dimethyl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethane-1,2-diamine |
| PubChem CID | 62574239 |
| Molecular Formula | C12H24F3N3 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | N',N'-dimethyl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNCCN1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H24F3N3/c1-17(2)8-5-16-6-9-18-7-3-4-11(10-18)12(13,14)15/h11,16H,3-10H2,1-2H3 |
| InChIKey | RHLIZIKNRHEZED-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N',N'-dimethyl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-dimethyl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethane-1,2-diamine?
The IUPAC name of N',N'-dimethyl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethane-1,2-diamine (CID 62574239) is N',N'-dimethyl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethane-1,2-diamine.
What is the SMILES notation for N',N'-dimethyl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethane-1,2-diamine?
The canonical SMILES for N',N'-dimethyl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethane-1,2-diamine is CN(C)CCNCCN1CCCC(C(F)(F)F)C1.
What is the InChIKey of N',N'-dimethyl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethane-1,2-diamine?
The InChIKey is RHLIZIKNRHEZED-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24F3N3/c1-17(2)8-5-16-6-9-18-7-3-4-11(10-18)12(13,14)15/h11,16H,3-10H2,1-2H3.
What are the key properties of N',N'-dimethyl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethane-1,2-diamine?
N',N'-dimethyl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethane-1,2-diamine has a molecular weight of 267.34 g/mol, XLogP of 1.41, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-dimethyl-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]ethane-1,2-diamine is sourced from PubChem (CID 62574239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).