About N-cycloheptyl-N'-methyl-N'-(1,3-thiazol-4-ylmethyl)ethane-1,2-diamine
N-cycloheptyl-N'-methyl-N'-(1,3-thiazol-4-ylmethyl)ethane-1,2-diamine (PubChem CID 62575304) has the molecular formula C14H25N3S
and a molecular weight of 267.44 g/mol. Its IUPAC name is N-cycloheptyl-N'-methyl-N'-(1,3-thiazol-4-ylmethyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-cycloheptyl-N'-methyl-N'-(1,3-thiazol-4-ylmethyl)ethane-1,2-diamine |
| PubChem CID | 62575304 |
| Molecular Formula | C14H25N3S |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N-cycloheptyl-N'-methyl-N'-(1,3-thiazol-4-ylmethyl)ethane-1,2-diamine |
| SMILES | CN(CCNC1CCCCCC1)Cc1cscn1 |
| InChI | InChI=1S/C14H25N3S/c1-17(10-14-11-18-12-16-14)9-8-15-13-6-4-2-3-5-7-13/h11-13,15H,2-10H2,1H3 |
| InChIKey | KHDHMZIKYVQNPY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cycloheptyl-N'-methyl-N'-(1,3-thiazol-4-ylmethyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-N'-methyl-N'-(1,3-thiazol-4-ylmethyl)ethane-1,2-diamine?
The IUPAC name of N-cycloheptyl-N'-methyl-N'-(1,3-thiazol-4-ylmethyl)ethane-1,2-diamine (CID 62575304) is N-cycloheptyl-N'-methyl-N'-(1,3-thiazol-4-ylmethyl)ethane-1,2-diamine.
What is the SMILES notation for N-cycloheptyl-N'-methyl-N'-(1,3-thiazol-4-ylmethyl)ethane-1,2-diamine?
The canonical SMILES for N-cycloheptyl-N'-methyl-N'-(1,3-thiazol-4-ylmethyl)ethane-1,2-diamine is CN(CCNC1CCCCCC1)Cc1cscn1.
What is the InChIKey of N-cycloheptyl-N'-methyl-N'-(1,3-thiazol-4-ylmethyl)ethane-1,2-diamine?
The InChIKey is KHDHMZIKYVQNPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3S/c1-17(10-14-11-18-12-16-14)9-8-15-13-6-4-2-3-5-7-13/h11-13,15H,2-10H2,1H3.
What are the key properties of N-cycloheptyl-N'-methyl-N'-(1,3-thiazol-4-ylmethyl)ethane-1,2-diamine?
N-cycloheptyl-N'-methyl-N'-(1,3-thiazol-4-ylmethyl)ethane-1,2-diamine has a molecular weight of 267.44 g/mol, XLogP of 2.89, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-N'-methyl-N'-(1,3-thiazol-4-ylmethyl)ethane-1,2-diamine is sourced from PubChem (CID 62575304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).