C15H26N4 — CID 62575359
N'-methyl-N'-(1-methylpiperidin-4-yl)-N-(pyridin-3-ylmethyl)ethane-1,2-diamine (PubChem CID 62575359) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is N'-methyl-N'-(1-methylpiperidin-4-yl)-N-(pyridin-3-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-(1-methylpiperidin-4-yl)-N-(pyridin-3-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62575359 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | N'-methyl-N'-(1-methylpiperidin-4-yl)-N-(pyridin-3-ylmethyl)ethane-1,2-diamine |
| SMILES | CN1CCC(N(C)CCNCc2cccnc2)CC1 |
| InChI | InChI=1S/C15H26N4/c1-18-9-5-15(6-10-18)19(2)11-8-17-13-14-4-3-7-16-12-14/h3-4,7,12,15,17H,5-6,8-11,13H2,1-2H3 |
| InChIKey | ZWOKBEPVJBCFCI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|