C10H9F6NO2 — CID 625760
3,5-bis(2,2,2-trifluoroethoxy)aniline (PubChem CID 625760) has the molecular formula C10H9F6NO2 and a molecular weight of 289.18 g/mol. Its IUPAC name is 3,5-bis(2,2,2-trifluoroethoxy)aniline.
| Compound Name | 3,5-bis(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 625760 |
| Molecular Formula | C10H9F6NO2 |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 3,5-bis(2,2,2-trifluoroethoxy)aniline |
| SMILES | Nc1cc(OCC(F)(F)F)cc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F6NO2/c11-9(12,13)4-18-7-1-6(17)2-8(3-7)19-5-10(14,15)16/h1-3H,4-5,17H2 |
| InChIKey | OSOJQURMIYYFAY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|