C13H18BrF3N2S — CID 62576060
N-[(4-bromothiophen-2-yl)methyl]-2-[3-(trifluoromethyl)piperidin-1-yl]ethanamine (PubChem CID 62576060) has the molecular formula C13H18BrF3N2S and a molecular weight of 371.27 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-[3-(trifluoromethyl)piperidin-1-yl]ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-[3-(trifluoromethyl)piperidin-1-yl]ethanamine |
|---|---|
| PubChem CID | 62576060 |
| Molecular Formula | C13H18BrF3N2S |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-[3-(trifluoromethyl)piperidin-1-yl]ethanamine |
| SMILES | FC(F)(F)C1CCCN(CCNCc2cc(Br)cs2)C1 |
| InChI | InChI=1S/C13H18BrF3N2S/c14-11-6-12(20-9-11)7-18-3-5-19-4-1-2-10(8-19)13(15,16)17/h6,9-10,18H,1-5,7-8H2 |
| InChIKey | VJWCXUFYIKYOJZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|