C13H15NS2 — CID 62577112
2-methyl-N-(2-thiophen-2-ylsulfanylethyl)aniline (PubChem CID 62577112) has the molecular formula C13H15NS2 and a molecular weight of 249.40 g/mol. Its IUPAC name is 2-methyl-N-(2-thiophen-2-ylsulfanylethyl)aniline.
| Compound Name | 2-methyl-N-(2-thiophen-2-ylsulfanylethyl)aniline |
|---|---|
| PubChem CID | 62577112 |
| Molecular Formula | C13H15NS2 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-methyl-N-(2-thiophen-2-ylsulfanylethyl)aniline |
| SMILES | Cc1ccccc1NCCSc1cccs1 |
| InChI | InChI=1S/C13H15NS2/c1-11-5-2-3-6-12(11)14-8-10-16-13-7-4-9-15-13/h2-7,9,14H,8,10H2,1H3 |
| InChIKey | ZVHDTMTWVCVFEJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|