C12H20N2OS2 — CID 62577678
N-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethyl]-1-(oxolan-2-yl)ethanamine (PubChem CID 62577678) has the molecular formula C12H20N2OS2 and a molecular weight of 272.44 g/mol. Its IUPAC name is N-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethyl]-1-(oxolan-2-yl)ethanamine.
| Compound Name | N-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethyl]-1-(oxolan-2-yl)ethanamine |
|---|---|
| PubChem CID | 62577678 |
| Molecular Formula | C12H20N2OS2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | N-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethyl]-1-(oxolan-2-yl)ethanamine |
| SMILES | Cc1csc(SCCNC(C)C2CCCO2)n1 |
| InChI | InChI=1S/C12H20N2OS2/c1-9-8-17-12(14-9)16-7-5-13-10(2)11-4-3-6-15-11/h8,10-11,13H,3-7H2,1-2H3 |
| InChIKey | NYVSVQUKJHLMJK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|