C16H28N4S — CID 62577706
N-[2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3,3-dimethylbutan-1-amine (PubChem CID 62577706) has the molecular formula C16H28N4S and a molecular weight of 308.50 g/mol. Its IUPAC name is N-[2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3,3-dimethylbutan-1-amine.
| Compound Name | N-[2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 62577706 |
| Molecular Formula | C16H28N4S |
| Molecular Weight | 308.50 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | N-[2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3,3-dimethylbutan-1-amine |
| SMILES | CC(C)(C)CCNCCSc1nnc(C2CC2)n1C1CC1 |
| InChI | InChI=1S/C16H28N4S/c1-16(2,3)8-9-17-10-11-21-15-19-18-14(12-4-5-12)20(15)13-6-7-13/h12-13,17H,4-11H2,1-3H3 |
| InChIKey | TWHGAEHPYJDFKV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|