C10H13N5S — CID 62579417
N-(pyridin-2-ylmethyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)ethanamine (PubChem CID 62579417) has the molecular formula C10H13N5S and a molecular weight of 235.32 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)ethanamine.
| Compound Name | N-(pyridin-2-ylmethyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 62579417 |
| Molecular Formula | C10H13N5S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)ethanamine |
| SMILES | c1ccc(CNCCSc2ncn[nH]2)nc1 |
| InChI | InChI=1S/C10H13N5S/c1-2-4-12-9(3-1)7-11-5-6-16-10-13-8-14-15-10/h1-4,8,11H,5-7H2,(H,13,14,15) |
| InChIKey | IIICVJUBGJUUIZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|