C8H7F6N3O2 — CID 62579610
2,2,2-trifluoro-1-[1-[2-(2,2,2-trifluoroethoxy)ethyl]triazol-4-yl]ethanone (PubChem CID 62579610) has the molecular formula C8H7F6N3O2 and a molecular weight of 291.15 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[1-[2-(2,2,2-trifluoroethoxy)ethyl]triazol-4-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[1-[2-(2,2,2-trifluoroethoxy)ethyl]triazol-4-yl]ethanone |
|---|---|
| PubChem CID | 62579610 |
| Molecular Formula | C8H7F6N3O2 |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2,2,2-trifluoro-1-[1-[2-(2,2,2-trifluoroethoxy)ethyl]triazol-4-yl]ethanone |
| SMILES | O=C(c1cn(CCOCC(F)(F)F)nn1)C(F)(F)F |
| InChI | InChI=1S/C8H7F6N3O2/c9-7(10,11)4-19-2-1-17-3-5(15-16-17)6(18)8(12,13)14/h3H,1-2,4H2 |
| InChIKey | ZVBBXYCTJFSTEU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|