About N-(2-methoxyphenyl)-2,4-dinitroaniline
N-(2-methoxyphenyl)-2,4-dinitroaniline (PubChem CID 625801) has the molecular formula C13H11N3O5
and a molecular weight of 289.25 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2,4-dinitroaniline.
Molecular Properties
| Compound Name | N-(2-methoxyphenyl)-2,4-dinitroaniline |
| PubChem CID | 625801 |
| Molecular Formula | C13H11N3O5 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N-(2-methoxyphenyl)-2,4-dinitroaniline |
| SMILES | COc1ccccc1Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11N3O5/c1-21-13-5-3-2-4-11(13)14-10-7-6-9(15(17)18)8-12(10)16(19)20/h2-8,14H,1H3 |
| InChIKey | MSTPRMHOPCALQB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyphenyl)-2,4-dinitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyphenyl)-2,4-dinitroaniline?
The IUPAC name of N-(2-methoxyphenyl)-2,4-dinitroaniline (CID 625801) is N-(2-methoxyphenyl)-2,4-dinitroaniline.
What is the SMILES notation for N-(2-methoxyphenyl)-2,4-dinitroaniline?
The canonical SMILES for N-(2-methoxyphenyl)-2,4-dinitroaniline is COc1ccccc1Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of N-(2-methoxyphenyl)-2,4-dinitroaniline?
The InChIKey is MSTPRMHOPCALQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O5/c1-21-13-5-3-2-4-11(13)14-10-7-6-9(15(17)18)8-12(10)16(19)20/h2-8,14H,1H3.
What are the key properties of N-(2-methoxyphenyl)-2,4-dinitroaniline?
N-(2-methoxyphenyl)-2,4-dinitroaniline has a molecular weight of 289.25 g/mol, XLogP of 3.26, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyphenyl)-2,4-dinitroaniline is sourced from PubChem (CID 625801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).