About 1-[1-[(5-bromofuran-2-yl)methyl]triazol-4-yl]-2,2,2-trifluoroethanone
1-[1-[(5-bromofuran-2-yl)methyl]triazol-4-yl]-2,2,2-trifluoroethanone (PubChem CID 62580536) has the molecular formula C9H5BrF3N3O2
and a molecular weight of 324.06 g/mol. Its IUPAC name is 1-[1-[(5-bromofuran-2-yl)methyl]triazol-4-yl]-2,2,2-trifluoroethanone.
Molecular Properties
| Compound Name | 1-[1-[(5-bromofuran-2-yl)methyl]triazol-4-yl]-2,2,2-trifluoroethanone |
| PubChem CID | 62580536 |
| Molecular Formula | C9H5BrF3N3O2 |
| Molecular Weight | 324.06 g/mol |
| Exact Mass | 322.95 |
| IUPAC Name | 1-[1-[(5-bromofuran-2-yl)methyl]triazol-4-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cn(Cc2ccc(Br)o2)nn1)C(F)(F)F |
| InChI | InChI=1S/C9H5BrF3N3O2/c10-7-2-1-5(18-7)3-16-4-6(14-15-16)8(17)9(11,12)13/h1-2,4H,3H2 |
| InChIKey | OLWICJOMFDZORD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.06 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[1-[(5-bromofuran-2-yl)methyl]triazol-4-yl]-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(5-bromofuran-2-yl)methyl]triazol-4-yl]-2,2,2-trifluoroethanone?
The IUPAC name of 1-[1-[(5-bromofuran-2-yl)methyl]triazol-4-yl]-2,2,2-trifluoroethanone (CID 62580536) is 1-[1-[(5-bromofuran-2-yl)methyl]triazol-4-yl]-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-[1-[(5-bromofuran-2-yl)methyl]triazol-4-yl]-2,2,2-trifluoroethanone?
The canonical SMILES for 1-[1-[(5-bromofuran-2-yl)methyl]triazol-4-yl]-2,2,2-trifluoroethanone is O=C(c1cn(Cc2ccc(Br)o2)nn1)C(F)(F)F.
What is the InChIKey of 1-[1-[(5-bromofuran-2-yl)methyl]triazol-4-yl]-2,2,2-trifluoroethanone?
The InChIKey is OLWICJOMFDZORD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrF3N3O2/c10-7-2-1-5(18-7)3-16-4-6(14-15-16)8(17)9(11,12)13/h1-2,4H,3H2.
What are the key properties of 1-[1-[(5-bromofuran-2-yl)methyl]triazol-4-yl]-2,2,2-trifluoroethanone?
1-[1-[(5-bromofuran-2-yl)methyl]triazol-4-yl]-2,2,2-trifluoroethanone has a molecular weight of 324.06 g/mol, XLogP of 2.43, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(5-bromofuran-2-yl)methyl]triazol-4-yl]-2,2,2-trifluoroethanone is sourced from PubChem (CID 62580536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).